C11H19NO5 — CID 81324118
2-[2-methoxyethyl-(5-methyloxolane-2-carbonyl)amino]acetic acid (PubChem CID 81324118) has the molecular formula C11H19NO5 and a molecular weight of 245.27 g/mol. Its IUPAC name is 2-[2-methoxyethyl-(5-methyloxolane-2-carbonyl)amino]acetic acid.
| Compound Name | 2-[2-methoxyethyl-(5-methyloxolane-2-carbonyl)amino]acetic acid |
|---|---|
| PubChem CID | 81324118 |
| Molecular Formula | C11H19NO5 |
| Molecular Weight | 245.27 g/mol |
| Exact Mass | 245.13 |
| IUPAC Name | 2-[2-methoxyethyl-(5-methyloxolane-2-carbonyl)amino]acetic acid |
| SMILES | COCCN(CC(=O)O)C(=O)C1CCC(C)O1 |
| InChI | InChI=1S/C11H19NO5/c1-8-3-4-9(17-8)11(15)12(5-6-16-2)7-10(13)14/h8-9H,3-7H2,1-2H3,(H,13,14) |
| InChIKey | SESPTPUKCMLAOC-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.27 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |