C16H23Cl2NO — CID 7929494
(1R)-N-[(1S)-1-(1-adamantyl)ethyl]-2,2-dichlorocyclopropane-1-carboxamide (PubChem CID 7929494) has the molecular formula C16H23Cl2NO and a molecular weight of 316.27 g/mol. Its IUPAC name is (1R)-N-[(1S)-1-(1-adamantyl)ethyl]-2,2-dichlorocyclopropane-1-carboxamide.
| Compound Name | (1R)-N-[(1S)-1-(1-adamantyl)ethyl]-2,2-dichlorocyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 7929494 |
| Molecular Formula | C16H23Cl2NO |
| Molecular Weight | 316.27 g/mol |
| Exact Mass | 315.12 |
| IUPAC Name | (1R)-N-[(1S)-1-(1-adamantyl)ethyl]-2,2-dichlorocyclopropane-1-carboxamide |
| SMILES | C[C@H](NC(=O)[C@H]1CC1(Cl)Cl)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C16H23Cl2NO/c1-9(19-14(20)13-8-16(13,17)18)15-5-10-2-11(6-15)4-12(3-10)7-15/h9-13H,2-8H2,1H3,(H,19,20)/t9-,10?,11?,12?,13+,15?/m0/s1 |
| InChIKey | SEDGBECUCORZLM-DNXSLQQOSA-N |
| XLogP | 3.90 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.27 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|