C20H39N3O5 — CID 54477212
(2S,3S)-N-[(3S)-4-deuterio-3-formyl-6-hydroxy-3-[2-hydroxypropyl(methyl)amino]-2-oxoheptyl]-N,3-dimethyl-2-(methylamino)pentanamide (PubChem CID 54477212) has the molecular formula C20H39N3O5 and a molecular weight of 402.55 g/mol. Its IUPAC name is (2S,3S)-N-[(3S)-4-deuterio-3-formyl-6-hydroxy-3-[2-hydroxypropyl(methyl)amino]-2-oxoheptyl]-N,3-dimethyl-2-(methylamino)pentanamide.
| Compound Name | (2S,3S)-N-[(3S)-4-deuterio-3-formyl-6-hydroxy-3-[2-hydroxypropyl(methyl)amino]-2-oxoheptyl]-N,3-dimethyl-2-(methylamino)pentanamide |
|---|---|
| PubChem CID | 54477212 |
| Molecular Formula | C20H39N3O5 |
| Molecular Weight | 402.55 g/mol |
| Exact Mass | 402.30 |
| IUPAC Name | (2S,3S)-N-[(3S)-4-deuterio-3-formyl-6-hydroxy-3-[2-hydroxypropyl(methyl)amino]-2-oxoheptyl]-N,3-dimethyl-2-(methylamino)pentanamide |
| SMILES | [2H]C(CC(C)O)[C@](C=O)(C(=O)CN(C)C(=O)[C@@H](NC)[C@@H](C)CC)N(C)CC(C)O |
| InChI | InChI=1S/C20H39N3O5/c1-8-14(2)18(21-5)19(28)22(6)12-17(27)20(13-24,10-9-15(3)25)23(7)11-16(4)26/h13-16,18,21,25-26H,8-12H2,1-7H3/t14-,15?,16?,18-,20-/m0/s1/i10D/t10?,14-,15?,16?,18-,20- |
| InChIKey | SZTYCIAJODCUGM-BABYPOCPSA-N |
| XLogP | 0.06 |
| TPSA | 110.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.55 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|