C12H24N2O5 — CID 154964460
5,5-dihydroxy-2-[[3-methyl-2-(methylamino)pentanoyl]amino]pentanoic acid (PubChem CID 154964460) has the molecular formula C12H24N2O5 and a molecular weight of 276.33 g/mol. Its IUPAC name is 5,5-dihydroxy-2-[[3-methyl-2-(methylamino)pentanoyl]amino]pentanoic acid.
| Compound Name | 5,5-dihydroxy-2-[[3-methyl-2-(methylamino)pentanoyl]amino]pentanoic acid |
|---|---|
| PubChem CID | 154964460 |
| Molecular Formula | C12H24N2O5 |
| Molecular Weight | 276.33 g/mol |
| Exact Mass | 276.17 |
| IUPAC Name | 5,5-dihydroxy-2-[[3-methyl-2-(methylamino)pentanoyl]amino]pentanoic acid |
| SMILES | CCC(C)C(NC)C(=O)NC(CCC(O)O)C(=O)O |
| InChI | InChI=1S/C12H24N2O5/c1-4-7(2)10(13-3)11(17)14-8(12(18)19)5-6-9(15)16/h7-10,13,15-16H,4-6H2,1-3H3,(H,14,17)(H,18,19) |
| InChIKey | WJULXMRYROMGEB-UHFFFAOYSA-N |
| XLogP | -0.72 |
| TPSA | 118.89 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.33 |
| LogP ≤ 5 | -0.72 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|