C11H21N3O5 — CID 114004858
(2S)-2-[[2-(carbamoylamino)-3-methylpentanoyl]amino]-4-hydroxybutanoic acid (PubChem CID 114004858) has the molecular formula C11H21N3O5 and a molecular weight of 275.31 g/mol. Its IUPAC name is (2S)-2-[[2-(carbamoylamino)-3-methylpentanoyl]amino]-4-hydroxybutanoic acid.
| Compound Name | (2S)-2-[[2-(carbamoylamino)-3-methylpentanoyl]amino]-4-hydroxybutanoic acid |
|---|---|
| PubChem CID | 114004858 |
| Molecular Formula | C11H21N3O5 |
| Molecular Weight | 275.31 g/mol |
| Exact Mass | 275.15 |
| IUPAC Name | (2S)-2-[[2-(carbamoylamino)-3-methylpentanoyl]amino]-4-hydroxybutanoic acid |
| SMILES | CCC(C)C(NC(N)=O)C(=O)N[C@@H](CCO)C(=O)O |
| InChI | InChI=1S/C11H21N3O5/c1-3-6(2)8(14-11(12)19)9(16)13-7(4-5-15)10(17)18/h6-8,15H,3-5H2,1-2H3,(H,13,16)(H,17,18)(H3,12,14,19)/t6?,7-,8?/m0/s1 |
| InChIKey | UQPKUBWCGJMBSZ-WTIBDHCWSA-N |
| XLogP | -0.98 |
| TPSA | 141.75 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.31 |
| LogP ≤ 5 | -0.98 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |