C12H21N3O6 — CID 82781084
2-[[2-(carbamoylamino)-3-methylbutanoyl]amino]-5-methoxy-5-oxopentanoic acid (PubChem CID 82781084) has the molecular formula C12H21N3O6 and a molecular weight of 303.32 g/mol. Its IUPAC name is 2-[[2-(carbamoylamino)-3-methylbutanoyl]amino]-5-methoxy-5-oxopentanoic acid.
| Compound Name | 2-[[2-(carbamoylamino)-3-methylbutanoyl]amino]-5-methoxy-5-oxopentanoic acid |
|---|---|
| PubChem CID | 82781084 |
| Molecular Formula | C12H21N3O6 |
| Molecular Weight | 303.32 g/mol |
| Exact Mass | 303.14 |
| IUPAC Name | 2-[[2-(carbamoylamino)-3-methylbutanoyl]amino]-5-methoxy-5-oxopentanoic acid |
| SMILES | COC(=O)CCC(NC(=O)C(NC(N)=O)C(C)C)C(=O)O |
| InChI | InChI=1S/C12H21N3O6/c1-6(2)9(15-12(13)20)10(17)14-7(11(18)19)4-5-8(16)21-3/h6-7,9H,4-5H2,1-3H3,(H,14,17)(H,18,19)(H3,13,15,20) |
| InChIKey | ONUZNZJUPHRZHJ-UHFFFAOYSA-N |
| XLogP | -0.80 |
| TPSA | 147.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.32 |
| LogP ≤ 5 | -0.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |