C13H29N3O2 — CID 155088912
(2S,3S)-2-[[2-(dimethylamino)-1-hydroxy-2-methylpropyl]amino]-N,3-dimethylpentanamide (PubChem CID 155088912) has the molecular formula C13H29N3O2 and a molecular weight of 259.39 g/mol. Its IUPAC name is (2S,3S)-2-[[2-(dimethylamino)-1-hydroxy-2-methylpropyl]amino]-N,3-dimethylpentanamide.
| Compound Name | (2S,3S)-2-[[2-(dimethylamino)-1-hydroxy-2-methylpropyl]amino]-N,3-dimethylpentanamide |
|---|---|
| PubChem CID | 155088912 |
| Molecular Formula | C13H29N3O2 |
| Molecular Weight | 259.39 g/mol |
| Exact Mass | 259.23 |
| IUPAC Name | (2S,3S)-2-[[2-(dimethylamino)-1-hydroxy-2-methylpropyl]amino]-N,3-dimethylpentanamide |
| SMILES | CC[C@H](C)C(NC(O)C(C)(C)N(C)C)C(=O)NC |
| InChI | InChI=1S/C13H29N3O2/c1-8-9(2)10(11(17)14-5)15-12(18)13(3,4)16(6)7/h9-10,12,15,18H,8H2,1-7H3,(H,14,17)/t9-,10?,12?/m0/s1 |
| InChIKey | BJJKNUCPINMWBW-BMQDGWLCSA-N |
| XLogP | 0.40 |
| TPSA | 64.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.39 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|