C31H60N3O8+ — CID 54156683
[(4S,5S)-1-carboxy-1,9-dihydroxy-5-methyl-3-oxodecan-4-yl]-[(2S,3S)-7-hydroxy-3-methyl-2-[methyl-[(2S,3S)-3-methyl-2-(methylamino)pentanoyl]amino]octanoyl]-dimethylazanium (PubChem CID 54156683) has the molecular formula C31H60N3O8+ and a molecular weight of 602.83 g/mol. Its IUPAC name is [(4S,5S)-1-carboxy-1,9-dihydroxy-5-methyl-3-oxodecan-4-yl]-[(2S,3S)-7-hydroxy-3-methyl-2-[methyl-[(2S,3S)-3-methyl-2-(methylamino)pentanoyl]amino]octanoyl]-dimethylazanium.
| Compound Name | [(4S,5S)-1-carboxy-1,9-dihydroxy-5-methyl-3-oxodecan-4-yl]-[(2S,3S)-7-hydroxy-3-methyl-2-[methyl-[(2S,3S)-3-methyl-2-(methylamino)pentanoyl]amino]octanoyl]-dimethylazanium |
|---|---|
| PubChem CID | 54156683 |
| Molecular Formula | C31H60N3O8+ |
| Molecular Weight | 602.83 g/mol |
| Exact Mass | 602.44 |
| IUPAC Name | [(4S,5S)-1-carboxy-1,9-dihydroxy-5-methyl-3-oxodecan-4-yl]-[(2S,3S)-7-hydroxy-3-methyl-2-[methyl-[(2S,3S)-3-methyl-2-(methylamino)pentanoyl]amino]octanoyl]-dimethylazanium |
| SMILES | CC[C@H](C)[C@H](NC)C(=O)N(C)[C@H](C(=O)[N+](C)(C)[C@H](C(=O)CC(O)C(=O)O)[C@@H](C)CCCC(C)O)[C@@H](C)CCCC(C)O |
| InChI | InChI=1S/C31H59N3O8/c1-11-19(2)26(32-7)29(39)33(8)27(20(3)14-12-16-22(5)35)30(40)34(9,10)28(21(4)15-13-17-23(6)36)24(37)18-25(38)31(41)42/h19-23,25-28,32,35-36,38H,11-18H2,1-10H3/p+1/t19-,20-,21-,22?,23?,25?,26-,27-,28-/m0/s1 |
| InChIKey | PYDTYUKZQBPPEX-RGURCECCSA-O |
| XLogP | 2.20 |
| TPSA | 164.47 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.83 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|