C16H33N3O3 — CID 135182285
3-methoxy-5-methyl-4-[methyl-[3-methyl-2-(methylamino)butanoyl]amino]heptanamide (PubChem CID 135182285) has the molecular formula C16H33N3O3 and a molecular weight of 315.46 g/mol. Its IUPAC name is 3-methoxy-5-methyl-4-[methyl-[3-methyl-2-(methylamino)butanoyl]amino]heptanamide.
| Compound Name | 3-methoxy-5-methyl-4-[methyl-[3-methyl-2-(methylamino)butanoyl]amino]heptanamide |
|---|---|
| PubChem CID | 135182285 |
| Molecular Formula | C16H33N3O3 |
| Molecular Weight | 315.46 g/mol |
| Exact Mass | 315.25 |
| IUPAC Name | 3-methoxy-5-methyl-4-[methyl-[3-methyl-2-(methylamino)butanoyl]amino]heptanamide |
| SMILES | CCC(C)C(C(CC(N)=O)OC)N(C)C(=O)C(NC)C(C)C |
| InChI | InChI=1S/C16H33N3O3/c1-8-11(4)15(12(22-7)9-13(17)20)19(6)16(21)14(18-5)10(2)3/h10-12,14-15,18H,8-9H2,1-7H3,(H2,17,20) |
| InChIKey | ROCVRTSUYYXTFZ-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.46 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |