C12H24N2O3 — CID 153499920
(3R,4S,5S)-4-[acetyl(methyl)amino]-3-methoxy-5-methylheptanamide (PubChem CID 153499920) has the molecular formula C12H24N2O3 and a molecular weight of 244.33 g/mol. Its IUPAC name is (3R,4S,5S)-4-[acetyl(methyl)amino]-3-methoxy-5-methylheptanamide.
| Compound Name | (3R,4S,5S)-4-[acetyl(methyl)amino]-3-methoxy-5-methylheptanamide |
|---|---|
| PubChem CID | 153499920 |
| Molecular Formula | C12H24N2O3 |
| Molecular Weight | 244.33 g/mol |
| Exact Mass | 244.18 |
| IUPAC Name | (3R,4S,5S)-4-[acetyl(methyl)amino]-3-methoxy-5-methylheptanamide |
| SMILES | CC[C@H](C)[C@@H]([C@@H](CC(N)=O)OC)N(C)C(C)=O |
| InChI | InChI=1S/C12H24N2O3/c1-6-8(2)12(14(4)9(3)15)10(17-5)7-11(13)16/h8,10,12H,6-7H2,1-5H3,(H2,13,16)/t8-,10+,12-/m0/s1 |
| InChIKey | FJEUOXGAOAGOFG-XRNSZHNASA-N |
| XLogP | 0.77 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.33 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |