C23H46FN3O5 — CID 142398728
N-(7-amino-7-oxoheptyl)-N-fluoro-3-methoxy-5-methyl-4-[methyl(3-methylbutanoyl)amino]heptanamide;methanol (PubChem CID 142398728) has the molecular formula C23H46FN3O5 and a molecular weight of 463.64 g/mol. Its IUPAC name is N-(7-amino-7-oxoheptyl)-N-fluoro-3-methoxy-5-methyl-4-[methyl(3-methylbutanoyl)amino]heptanamide;methanol.
| Compound Name | N-(7-amino-7-oxoheptyl)-N-fluoro-3-methoxy-5-methyl-4-[methyl(3-methylbutanoyl)amino]heptanamide;methanol |
|---|---|
| PubChem CID | 142398728 |
| Molecular Formula | C23H46FN3O5 |
| Molecular Weight | 463.64 g/mol |
| Exact Mass | 463.34 |
| IUPAC Name | N-(7-amino-7-oxoheptyl)-N-fluoro-3-methoxy-5-methyl-4-[methyl(3-methylbutanoyl)amino]heptanamide;methanol |
| SMILES | CCC(C)C(C(CC(=O)N(F)CCCCCCC(N)=O)OC)N(C)C(=O)CC(C)C.CO |
| InChI | InChI=1S/C22H42FN3O4.CH4O/c1-7-17(4)22(25(5)20(28)14-16(2)3)18(30-6)15-21(29)26(23)13-11-9-8-10-12-19(24)27;1-2/h16-18,22H,7-15H2,1-6H3,(H2,24,27);2H,1H3 |
| InChIKey | MPPHHWGGCWOJJI-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 113.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.64 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|