C18H36N2O3 — CID 146429271
3-(dimethylamino)-N-(3-methoxy-5-methyl-1-oxoheptan-4-yl)-N,4-dimethylpentanamide (PubChem CID 146429271) has the molecular formula C18H36N2O3 and a molecular weight of 328.50 g/mol. Its IUPAC name is 3-(dimethylamino)-N-(3-methoxy-5-methyl-1-oxoheptan-4-yl)-N,4-dimethylpentanamide.
| Compound Name | 3-(dimethylamino)-N-(3-methoxy-5-methyl-1-oxoheptan-4-yl)-N,4-dimethylpentanamide |
|---|---|
| PubChem CID | 146429271 |
| Molecular Formula | C18H36N2O3 |
| Molecular Weight | 328.50 g/mol |
| Exact Mass | 328.27 |
| IUPAC Name | 3-(dimethylamino)-N-(3-methoxy-5-methyl-1-oxoheptan-4-yl)-N,4-dimethylpentanamide |
| SMILES | CCC(C)C(C(CC=O)OC)N(C)C(=O)CC(C(C)C)N(C)C |
| InChI | InChI=1S/C18H36N2O3/c1-9-14(4)18(16(23-8)10-11-21)20(7)17(22)12-15(13(2)3)19(5)6/h11,13-16,18H,9-10,12H2,1-8H3 |
| InChIKey | XLYCUMZWOGHDOE-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.50 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|