About formic acid;N-(3-methoxy-5-methylheptan-4-yl)-N,3-dimethylbutanamide
formic acid;N-(3-methoxy-5-methylheptan-4-yl)-N,3-dimethylbutanamide (PubChem CID 144871353) has the molecular formula C16H33NO4
and a molecular weight of 303.44 g/mol. Its IUPAC name is formic acid;N-(3-methoxy-5-methylheptan-4-yl)-N,3-dimethylbutanamide.
Molecular Properties
| Compound Name | formic acid;N-(3-methoxy-5-methylheptan-4-yl)-N,3-dimethylbutanamide |
| PubChem CID | 144871353 |
| Molecular Formula | C16H33NO4 |
| Molecular Weight | 303.44 g/mol |
| Exact Mass | 303.24 |
| IUPAC Name | formic acid;N-(3-methoxy-5-methylheptan-4-yl)-N,3-dimethylbutanamide |
| SMILES | CCC(C)C(C(CC)OC)N(C)C(=O)CC(C)C.O=CO |
| InChI | InChI=1S/C15H31NO2.CH2O2/c1-8-12(5)15(13(9-2)18-7)16(6)14(17)10-11(3)4;2-1-3/h11-13,15H,8-10H2,1-7H3;1H,(H,2,3) |
| InChIKey | GTVFRYBOYYUUJS-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.44 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze formic acid;N-(3-methoxy-5-methylheptan-4-yl)-N,3-dimethylbutanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of formic acid;N-(3-methoxy-5-methylheptan-4-yl)-N,3-dimethylbutanamide?
The IUPAC name of formic acid;N-(3-methoxy-5-methylheptan-4-yl)-N,3-dimethylbutanamide (CID 144871353) is formic acid;N-(3-methoxy-5-methylheptan-4-yl)-N,3-dimethylbutanamide.
What is the SMILES notation for formic acid;N-(3-methoxy-5-methylheptan-4-yl)-N,3-dimethylbutanamide?
The canonical SMILES for formic acid;N-(3-methoxy-5-methylheptan-4-yl)-N,3-dimethylbutanamide is CCC(C)C(C(CC)OC)N(C)C(=O)CC(C)C.O=CO.
What is the InChIKey of formic acid;N-(3-methoxy-5-methylheptan-4-yl)-N,3-dimethylbutanamide?
The InChIKey is GTVFRYBOYYUUJS-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H31NO2.CH2O2/c1-8-12(5)15(13(9-2)18-7)16(6)14(17)10-11(3)4;2-1-3/h11-13,15H,8-10H2,1-7H3;1H,(H,2,3).
What are the key properties of formic acid;N-(3-methoxy-5-methylheptan-4-yl)-N,3-dimethylbutanamide?
formic acid;N-(3-methoxy-5-methylheptan-4-yl)-N,3-dimethylbutanamide has a molecular weight of 303.44 g/mol, XLogP of 3.03, 8 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for formic acid;N-(3-methoxy-5-methylheptan-4-yl)-N,3-dimethylbutanamide is sourced from PubChem (CID 144871353), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).