C16H33NO4 — CID 144871353
formic acid;N-(3-methoxy-5-methylheptan-4-yl)-N,3-dimethylbutanamide (PubChem CID 144871353) has the molecular formula C16H33NO4 and a molecular weight of 303.44 g/mol. Its IUPAC name is formic acid;N-(3-methoxy-5-methylheptan-4-yl)-N,3-dimethylbutanamide.
| Compound Name | formic acid;N-(3-methoxy-5-methylheptan-4-yl)-N,3-dimethylbutanamide |
|---|---|
| PubChem CID | 144871353 |
| Molecular Formula | C16H33NO4 |
| Molecular Weight | 303.44 g/mol |
| Exact Mass | 303.24 |
| IUPAC Name | formic acid;N-(3-methoxy-5-methylheptan-4-yl)-N,3-dimethylbutanamide |
| SMILES | CCC(C)C(C(CC)OC)N(C)C(=O)CC(C)C.O=CO |
| InChI | InChI=1S/C15H31NO2.CH2O2/c1-8-12(5)15(13(9-2)18-7)16(6)14(17)10-11(3)4;2-1-3/h11-13,15H,8-10H2,1-7H3;1H,(H,2,3) |
| InChIKey | GTVFRYBOYYUUJS-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.44 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|