C22H45N3O4 — CID 176564647
2-formamido-N-(5-methoxy-3-methyl-7-oxooctan-4-yl)-N-methylacetamide;1-methylpyrrolidine;propane (PubChem CID 176564647) has the molecular formula C22H45N3O4 and a molecular weight of 415.62 g/mol. Its IUPAC name is 2-formamido-N-(5-methoxy-3-methyl-7-oxooctan-4-yl)-N-methylacetamide;1-methylpyrrolidine;propane.
| Compound Name | 2-formamido-N-(5-methoxy-3-methyl-7-oxooctan-4-yl)-N-methylacetamide;1-methylpyrrolidine;propane |
|---|---|
| PubChem CID | 176564647 |
| Molecular Formula | C22H45N3O4 |
| Molecular Weight | 415.62 g/mol |
| Exact Mass | 415.34 |
| IUPAC Name | 2-formamido-N-(5-methoxy-3-methyl-7-oxooctan-4-yl)-N-methylacetamide;1-methylpyrrolidine;propane |
| SMILES | CCC.CCC(C)C(C(CC(C)=O)OC)N(C)C(=O)CNC=O.CN1CCCC1 |
| InChI | InChI=1S/C14H26N2O4.C5H11N.C3H8/c1-6-10(2)14(12(20-5)7-11(3)18)16(4)13(19)8-15-9-17;1-6-4-2-3-5-6;1-3-2/h9-10,12,14H,6-8H2,1-5H3,(H,15,17);2-5H2,1H3;3H2,1-2H3 |
| InChIKey | DTGZXGCFINLWBR-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.62 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|