C18H33NO4 — CID 155120910
tert-butyl (3R,4S,5S)-4-[but-3-enoyl(methyl)amino]-3-methoxy-5-methylheptanoate (PubChem CID 155120910) has the molecular formula C18H33NO4 and a molecular weight of 327.47 g/mol. Its IUPAC name is tert-butyl (3R,4S,5S)-4-[but-3-enoyl(methyl)amino]-3-methoxy-5-methylheptanoate.
| Compound Name | tert-butyl (3R,4S,5S)-4-[but-3-enoyl(methyl)amino]-3-methoxy-5-methylheptanoate |
|---|---|
| PubChem CID | 155120910 |
| Molecular Formula | C18H33NO4 |
| Molecular Weight | 327.47 g/mol |
| Exact Mass | 327.24 |
| IUPAC Name | tert-butyl (3R,4S,5S)-4-[but-3-enoyl(methyl)amino]-3-methoxy-5-methylheptanoate |
| SMILES | C=CCC(=O)N(C)[C@@H]([C@@H](C)CC)[C@@H](CC(=O)OC(C)(C)C)OC |
| InChI | InChI=1S/C18H33NO4/c1-9-11-15(20)19(7)17(13(3)10-2)14(22-8)12-16(21)23-18(4,5)6/h9,13-14,17H,1,10-12H2,2-8H3/t13-,14+,17-/m0/s1 |
| InChIKey | DTTAFLZZXGBDPV-VBQJREDUSA-N |
| XLogP | 3.18 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.47 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|