C11H23NO3 — CID 59021635
tert-butyl (3R)-3-methoxy-4-(methylamino)pentanoate (PubChem CID 59021635) has the molecular formula C11H23NO3 and a molecular weight of 217.31 g/mol. Its IUPAC name is tert-butyl (3R)-3-methoxy-4-(methylamino)pentanoate.
| Compound Name | tert-butyl (3R)-3-methoxy-4-(methylamino)pentanoate |
|---|---|
| PubChem CID | 59021635 |
| Molecular Formula | C11H23NO3 |
| Molecular Weight | 217.31 g/mol |
| Exact Mass | 217.17 |
| IUPAC Name | tert-butyl (3R)-3-methoxy-4-(methylamino)pentanoate |
| SMILES | CNC(C)[C@@H](CC(=O)OC(C)(C)C)OC |
| InChI | InChI=1S/C11H23NO3/c1-8(12-5)9(14-6)7-10(13)15-11(2,3)4/h8-9,12H,7H2,1-6H3/t8?,9-/m1/s1 |
| InChIKey | YHSMDHCANJVWRR-YGPZHTELSA-N |
| XLogP | 1.34 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.31 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |