C13H27NO3 — CID 126961489
tert-butyl (3S,4S,5S)-4-amino-3-methoxy-5-methylheptanoate (PubChem CID 126961489) has the molecular formula C13H27NO3 and a molecular weight of 245.36 g/mol. Its IUPAC name is tert-butyl (3S,4S,5S)-4-amino-3-methoxy-5-methylheptanoate.
| Compound Name | tert-butyl (3S,4S,5S)-4-amino-3-methoxy-5-methylheptanoate |
|---|---|
| PubChem CID | 126961489 |
| Molecular Formula | C13H27NO3 |
| Molecular Weight | 245.36 g/mol |
| Exact Mass | 245.20 |
| IUPAC Name | tert-butyl (3S,4S,5S)-4-amino-3-methoxy-5-methylheptanoate |
| SMILES | CC[C@H](C)[C@H](N)[C@H](CC(=O)OC(C)(C)C)OC |
| InChI | InChI=1S/C13H27NO3/c1-7-9(2)12(14)10(16-6)8-11(15)17-13(3,4)5/h9-10,12H,7-8,14H2,1-6H3/t9-,10-,12-/m0/s1 |
| InChIKey | YVLYJUOMVQYWIL-NHCYSSNCSA-N |
| XLogP | 2.11 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.36 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |