C14H28ClNO3 — CID 89318075
tert-butyl (3R,4S,5S)-4-[chloro(methyl)amino]-3-methoxy-5-methylheptanoate (PubChem CID 89318075) has the molecular formula C14H28ClNO3 and a molecular weight of 293.84 g/mol. Its IUPAC name is tert-butyl (3R,4S,5S)-4-[chloro(methyl)amino]-3-methoxy-5-methylheptanoate.
| Compound Name | tert-butyl (3R,4S,5S)-4-[chloro(methyl)amino]-3-methoxy-5-methylheptanoate |
|---|---|
| PubChem CID | 89318075 |
| Molecular Formula | C14H28ClNO3 |
| Molecular Weight | 293.84 g/mol |
| Exact Mass | 293.18 |
| IUPAC Name | tert-butyl (3R,4S,5S)-4-[chloro(methyl)amino]-3-methoxy-5-methylheptanoate |
| SMILES | CC[C@H](C)[C@@H]([C@@H](CC(=O)OC(C)(C)C)OC)N(C)Cl |
| InChI | InChI=1S/C14H28ClNO3/c1-8-10(2)13(16(6)15)11(18-7)9-12(17)19-14(3,4)5/h10-11,13H,8-9H2,1-7H3/t10-,11+,13-/m0/s1 |
| InChIKey | ALEPGHFSHVGPHT-LOWVWBTDSA-N |
| XLogP | 3.23 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.84 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|