C11H22ClNO3 — CID 89318052
tert-butyl (3R,4S)-4-[chloro(methyl)amino]-3-methoxypentanoate (PubChem CID 89318052) has the molecular formula C11H22ClNO3 and a molecular weight of 251.75 g/mol. Its IUPAC name is tert-butyl (3R,4S)-4-[chloro(methyl)amino]-3-methoxypentanoate.
| Compound Name | tert-butyl (3R,4S)-4-[chloro(methyl)amino]-3-methoxypentanoate |
|---|---|
| PubChem CID | 89318052 |
| Molecular Formula | C11H22ClNO3 |
| Molecular Weight | 251.75 g/mol |
| Exact Mass | 251.13 |
| IUPAC Name | tert-butyl (3R,4S)-4-[chloro(methyl)amino]-3-methoxypentanoate |
| SMILES | CO[C@H](CC(=O)OC(C)(C)C)[C@H](C)N(C)Cl |
| InChI | InChI=1S/C11H22ClNO3/c1-8(13(5)12)9(15-6)7-10(14)16-11(2,3)4/h8-9H,7H2,1-6H3/t8-,9+/m0/s1 |
| InChIKey | IZUKHZFNPVCCIV-DTWKUNHWSA-N |
| XLogP | 2.21 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.75 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|