tert-butyl (3S)-3-(methoxymethyl)-4-methylpentanoate

C12H24O3 — CID 123336860

IUPACtert-butyl (3S)-3-(methoxymethyl)-4-methylpentanoate
SMILESCOC[C@@H](CC(=O)OC(C)(C)C)C(C)C
InChIInChI=1S/C12H24O3/c1-9(2)10(8-14-6)7-11(13)15-12(3,4)5/h9-10H,7-8H2,1-6H3/t10-/m1/s1
InChIKeyJYYINGQFFACDBD-SNVBAGLBSA-N
MW216.32 g/mol
LogP2.64
Rot. Bonds5

About tert-butyl (3S)-3-(methoxymethyl)-4-methylpentanoate

tert-butyl (3S)-3-(methoxymethyl)-4-methylpentanoate (PubChem CID 123336860) has the molecular formula C12H24O3 and a molecular weight of 216.32 g/mol. Its IUPAC name is tert-butyl (3S)-3-(methoxymethyl)-4-methylpentanoate.

Molecular Properties

Compound Nametert-butyl (3S)-3-(methoxymethyl)-4-methylpentanoate
PubChem CID123336860
Molecular FormulaC12H24O3
Molecular Weight216.32 g/mol
Exact Mass216.17
IUPAC Nametert-butyl (3S)-3-(methoxymethyl)-4-methylpentanoate
SMILESCOC[C@@H](CC(=O)OC(C)(C)C)C(C)C
InChIInChI=1S/C12H24O3/c1-9(2)10(8-14-6)7-11(13)15-12(3,4)5/h9-10H,7-8H2,1-6H3/t10-/m1/s1
InChIKeyJYYINGQFFACDBD-SNVBAGLBSA-N
XLogP2.64
TPSA35.53 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds5
Heavy Atoms15
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500216.32
LogP ≤ 52.64
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Analyze tert-butyl (3S)-3-(methoxymethyl)-4-methylpentanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of tert-butyl (3S)-3-(methoxymethyl)-4-methylpentanoate?
The IUPAC name of tert-butyl (3S)-3-(methoxymethyl)-4-methylpentanoate (CID 123336860) is tert-butyl (3S)-3-(methoxymethyl)-4-methylpentanoate.
What is the SMILES notation for tert-butyl (3S)-3-(methoxymethyl)-4-methylpentanoate?
The canonical SMILES for tert-butyl (3S)-3-(methoxymethyl)-4-methylpentanoate is COC[C@@H](CC(=O)OC(C)(C)C)C(C)C.
What is the InChIKey of tert-butyl (3S)-3-(methoxymethyl)-4-methylpentanoate?
The InChIKey is JYYINGQFFACDBD-SNVBAGLBSA-N. The full InChI is InChI=1S/C12H24O3/c1-9(2)10(8-14-6)7-11(13)15-12(3,4)5/h9-10H,7-8H2,1-6H3/t10-/m1/s1.
What are the key properties of tert-butyl (3S)-3-(methoxymethyl)-4-methylpentanoate?
tert-butyl (3S)-3-(methoxymethyl)-4-methylpentanoate has a molecular weight of 216.32 g/mol, XLogP of 2.64, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl (3S)-3-(methoxymethyl)-4-methylpentanoate is sourced from PubChem (CID 123336860), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).