C11H23NO3 — CID 158447815
tert-butyl (3R,4R)-3-(aminomethyl)-4-methoxypentanoate (PubChem CID 158447815) has the molecular formula C11H23NO3 and a molecular weight of 217.31 g/mol. Its IUPAC name is tert-butyl (3R,4R)-3-(aminomethyl)-4-methoxypentanoate.
| Compound Name | tert-butyl (3R,4R)-3-(aminomethyl)-4-methoxypentanoate |
|---|---|
| PubChem CID | 158447815 |
| Molecular Formula | C11H23NO3 |
| Molecular Weight | 217.31 g/mol |
| Exact Mass | 217.17 |
| IUPAC Name | tert-butyl (3R,4R)-3-(aminomethyl)-4-methoxypentanoate |
| SMILES | CO[C@H](C)[C@@H](CN)CC(=O)OC(C)(C)C |
| InChI | InChI=1S/C11H23NO3/c1-8(14-5)9(7-12)6-10(13)15-11(2,3)4/h8-9H,6-7,12H2,1-5H3/t8-,9-/m1/s1 |
| InChIKey | UACZHVHSBVZDOO-RKDXNWHRSA-N |
| XLogP | 1.33 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.31 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |