C17H34N2O3 — CID 163255331
(5S)-N-(7-amino-7-oxoheptyl)-3-methoxy-4,5-dimethylheptanamide (PubChem CID 163255331) has the molecular formula C17H34N2O3 and a molecular weight of 314.47 g/mol. Its IUPAC name is (5S)-N-(7-amino-7-oxoheptyl)-3-methoxy-4,5-dimethylheptanamide.
| Compound Name | (5S)-N-(7-amino-7-oxoheptyl)-3-methoxy-4,5-dimethylheptanamide |
|---|---|
| PubChem CID | 163255331 |
| Molecular Formula | C17H34N2O3 |
| Molecular Weight | 314.47 g/mol |
| Exact Mass | 314.26 |
| IUPAC Name | (5S)-N-(7-amino-7-oxoheptyl)-3-methoxy-4,5-dimethylheptanamide |
| SMILES | CC[C@H](C)C(C)C(CC(=O)NCCCCCCC(N)=O)OC |
| InChI | InChI=1S/C17H34N2O3/c1-5-13(2)14(3)15(22-4)12-17(21)19-11-9-7-6-8-10-16(18)20/h13-15H,5-12H2,1-4H3,(H2,18,20)(H,19,21)/t13-,14?,15?/m0/s1 |
| InChIKey | QBHFMSCSLGIFOM-NFOMZHRRSA-N |
| XLogP | 2.63 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.47 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|