C19H38N2O4 — CID 163255328
(3R,4S,5S)-N-[(5S,6R)-7-amino-5-methoxy-6-methyl-7-oxoheptyl]-3-methoxy-4,5-dimethylheptanamide (PubChem CID 163255328) has the molecular formula C19H38N2O4 and a molecular weight of 358.52 g/mol. Its IUPAC name is (3R,4S,5S)-N-[(5S,6R)-7-amino-5-methoxy-6-methyl-7-oxoheptyl]-3-methoxy-4,5-dimethylheptanamide.
| Compound Name | (3R,4S,5S)-N-[(5S,6R)-7-amino-5-methoxy-6-methyl-7-oxoheptyl]-3-methoxy-4,5-dimethylheptanamide |
|---|---|
| PubChem CID | 163255328 |
| Molecular Formula | C19H38N2O4 |
| Molecular Weight | 358.52 g/mol |
| Exact Mass | 358.28 |
| IUPAC Name | (3R,4S,5S)-N-[(5S,6R)-7-amino-5-methoxy-6-methyl-7-oxoheptyl]-3-methoxy-4,5-dimethylheptanamide |
| SMILES | CC[C@H](C)[C@H](C)[C@@H](CC(=O)NCCCC[C@H](OC)[C@@H](C)C(N)=O)OC |
| InChI | InChI=1S/C19H38N2O4/c1-7-13(2)14(3)17(25-6)12-18(22)21-11-9-8-10-16(24-5)15(4)19(20)23/h13-17H,7-12H2,1-6H3,(H2,20,23)(H,21,22)/t13-,14-,15+,16-,17+/m0/s1 |
| InChIKey | JOJGFCCKPIPDKI-ZOFXXKQRSA-N |
| XLogP | 2.50 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.52 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|