C14H26N4O4 — CID 59492094
6-(propanoylamino)-2-[[2-(propanoylamino)acetyl]amino]hexanamide (PubChem CID 59492094) has the molecular formula C14H26N4O4 and a molecular weight of 314.39 g/mol. Its IUPAC name is 6-(propanoylamino)-2-[[2-(propanoylamino)acetyl]amino]hexanamide.
| Compound Name | 6-(propanoylamino)-2-[[2-(propanoylamino)acetyl]amino]hexanamide |
|---|---|
| PubChem CID | 59492094 |
| Molecular Formula | C14H26N4O4 |
| Molecular Weight | 314.39 g/mol |
| Exact Mass | 314.20 |
| IUPAC Name | 6-(propanoylamino)-2-[[2-(propanoylamino)acetyl]amino]hexanamide |
| SMILES | CCC(=O)NCCCCC(NC(=O)CNC(=O)CC)C(N)=O |
| InChI | InChI=1S/C14H26N4O4/c1-3-11(19)16-8-6-5-7-10(14(15)22)18-13(21)9-17-12(20)4-2/h10H,3-9H2,1-2H3,(H2,15,22)(H,16,19)(H,17,20)(H,18,21) |
| InChIKey | HEGDNNATJIVNKY-UHFFFAOYSA-N |
| XLogP | -0.82 |
| TPSA | 130.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.39 |
| LogP ≤ 5 | -0.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|