C14H30N4O3 — CID 142574713
2-[(2-acetamidoacetyl)amino]-6-aminohexanamide;2-methylpropane (PubChem CID 142574713) has the molecular formula C14H30N4O3 and a molecular weight of 302.42 g/mol. Its IUPAC name is 2-[(2-acetamidoacetyl)amino]-6-aminohexanamide;2-methylpropane.
| Compound Name | 2-[(2-acetamidoacetyl)amino]-6-aminohexanamide;2-methylpropane |
|---|---|
| PubChem CID | 142574713 |
| Molecular Formula | C14H30N4O3 |
| Molecular Weight | 302.42 g/mol |
| Exact Mass | 302.23 |
| IUPAC Name | 2-[(2-acetamidoacetyl)amino]-6-aminohexanamide;2-methylpropane |
| SMILES | CC(=O)NCC(=O)NC(CCCCN)C(N)=O.CC(C)C |
| InChI | InChI=1S/C10H20N4O3.C4H10/c1-7(15)13-6-9(16)14-8(10(12)17)4-2-3-5-11;1-4(2)3/h8H,2-6,11H2,1H3,(H2,12,17)(H,13,15)(H,14,16);4H,1-3H3 |
| InChIKey | PKJRMKOEVKUQMW-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 127.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.42 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|