C17H33N5O4 — CID 170449138
2-[[2-(tert-butylamino)acetyl]amino]-6-[[(4Z)-4-hydroxyiminopentanoyl]amino]hexanamide (PubChem CID 170449138) has the molecular formula C17H33N5O4 and a molecular weight of 371.48 g/mol. Its IUPAC name is 2-[[2-(tert-butylamino)acetyl]amino]-6-[[(4Z)-4-hydroxyiminopentanoyl]amino]hexanamide.
| Compound Name | 2-[[2-(tert-butylamino)acetyl]amino]-6-[[(4Z)-4-hydroxyiminopentanoyl]amino]hexanamide |
|---|---|
| PubChem CID | 170449138 |
| Molecular Formula | C17H33N5O4 |
| Molecular Weight | 371.48 g/mol |
| Exact Mass | 371.25 |
| IUPAC Name | 2-[[2-(tert-butylamino)acetyl]amino]-6-[[(4Z)-4-hydroxyiminopentanoyl]amino]hexanamide |
| SMILES | C/C(CCC(=O)NCCCCC(NC(=O)CNC(C)(C)C)C(N)=O)=N/O |
| InChI | InChI=1S/C17H33N5O4/c1-12(22-26)8-9-14(23)19-10-6-5-7-13(16(18)25)21-15(24)11-20-17(2,3)4/h13,20,26H,5-11H2,1-4H3,(H2,18,25)(H,19,23)(H,21,24)/b22-12- |
| InChIKey | LTBCGTDISNPVMF-UUYOSTAYSA-N |
| XLogP | 0.26 |
| TPSA | 145.91 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.48 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|