C15H24N4O5 — CID 123991027
2-acetamido-6-[3-(2,5-dihydroxypyrrol-1-yl)propanoylamino]hexanamide (PubChem CID 123991027) has the molecular formula C15H24N4O5 and a molecular weight of 340.38 g/mol. Its IUPAC name is 2-acetamido-6-[3-(2,5-dihydroxypyrrol-1-yl)propanoylamino]hexanamide.
| Compound Name | 2-acetamido-6-[3-(2,5-dihydroxypyrrol-1-yl)propanoylamino]hexanamide |
|---|---|
| PubChem CID | 123991027 |
| Molecular Formula | C15H24N4O5 |
| Molecular Weight | 340.38 g/mol |
| Exact Mass | 340.17 |
| IUPAC Name | 2-acetamido-6-[3-(2,5-dihydroxypyrrol-1-yl)propanoylamino]hexanamide |
| SMILES | CC(=O)NC(CCCCNC(=O)CCn1c(O)ccc1O)C(N)=O |
| InChI | InChI=1S/C15H24N4O5/c1-10(20)18-11(15(16)24)4-2-3-8-17-12(21)7-9-19-13(22)5-6-14(19)23/h5-6,11,22-23H,2-4,7-9H2,1H3,(H2,16,24)(H,17,21)(H,18,20) |
| InChIKey | ZNUVRWUITLSKOU-UHFFFAOYSA-N |
| XLogP | -0.43 |
| TPSA | 146.68 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.38 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|