C12H21BN4O4 — CID 89108510
CID 89108510 (PubChem CID 89108510) has the molecular formula C12H21BN4O4 and a molecular weight of 296.14 g/mol.
| Compound Name | CID 89108510 |
|---|---|
| PubChem CID | 89108510 |
| Molecular Formula | C12H21BN4O4 |
| Molecular Weight | 296.14 g/mol |
| Exact Mass | 296.17 |
| IUPAC Name | — |
| SMILES | [B]C(=O)NCCC(=O)NC(CCCCNC(C)=O)C(N)=O |
| InChI | InChI=1S/C12H21BN4O4/c1-8(18)15-6-3-2-4-9(11(14)20)17-10(19)5-7-16-12(13)21/h9H,2-7H2,1H3,(H2,14,20)(H,15,18)(H,16,21)(H,17,19) |
| InChIKey | WSNOGBZHKXXULE-UHFFFAOYSA-N |
| XLogP | -1.47 |
| TPSA | 130.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.14 |
| LogP ≤ 5 | -1.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|