C46H84N12O12 — CID 90775563
6-[[2-[3-acetamidopropanoyl-[2-[(6-amino-5-methyl-6-oxohexyl)amino]-2-oxoethyl]amino]acetyl]amino]-2-methylhexanamide (PubChem CID 90775563) has the molecular formula C46H84N12O12 and a molecular weight of 997.25 g/mol. Its IUPAC name is 6-[[2-[3-acetamidopropanoyl-[2-[(6-amino-5-methyl-6-oxohexyl)amino]-2-oxoethyl]amino]acetyl]amino]-2-methylhexanamide.
| Compound Name | 6-[[2-[3-acetamidopropanoyl-[2-[(6-amino-5-methyl-6-oxohexyl)amino]-2-oxoethyl]amino]acetyl]amino]-2-methylhexanamide |
|---|---|
| PubChem CID | 90775563 |
| Molecular Formula | C46H84N12O12 |
| Molecular Weight | 997.25 g/mol |
| Exact Mass | 996.63 |
| IUPAC Name | 6-[[2-[3-acetamidopropanoyl-[2-[(6-amino-5-methyl-6-oxohexyl)amino]-2-oxoethyl]amino]acetyl]amino]-2-methylhexanamide |
| SMILES | CC(=O)NCCC(=O)N(CC(=O)NCCCCC(C)C(N)=O)CC(=O)NCCCCC(C)C(N)=O.CC(=O)NCCC(=O)N(CC(=O)NCCCCC(C)C(N)=O)CC(=O)NCCCCC(C)C(N)=O |
| InChI | InChI=1S/2C23H42N6O6/c2*1-16(22(24)34)8-4-6-11-27-19(31)14-29(21(33)10-13-26-18(3)30)15-20(32)28-12-7-5-9-17(2)23(25)35/h2*16-17H,4-15H2,1-3H3,(H2,24,34)(H2,25,35)(H,26,30)(H,27,31)(H,28,32) |
| InChIKey | KZIQGKGGCKDTQY-UHFFFAOYSA-N |
| XLogP | -1.69 |
| TPSA | 387.58 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 38 |
| Heavy Atoms | 70 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 997.25 |
| LogP ≤ 5 | -1.69 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|