C9H21N3O3 — CID 159782051
6-[(2-aminooxyacetyl)amino]-2-methylhexanamide;molecular hydrogen (PubChem CID 159782051) has the molecular formula C9H21N3O3 and a molecular weight of 219.28 g/mol. Its IUPAC name is 6-[(2-aminooxyacetyl)amino]-2-methylhexanamide;molecular hydrogen.
| Compound Name | 6-[(2-aminooxyacetyl)amino]-2-methylhexanamide;molecular hydrogen |
|---|---|
| PubChem CID | 159782051 |
| Molecular Formula | C9H21N3O3 |
| Molecular Weight | 219.28 g/mol |
| Exact Mass | 219.16 |
| IUPAC Name | 6-[(2-aminooxyacetyl)amino]-2-methylhexanamide;molecular hydrogen |
| SMILES | CC(CCCCNC(=O)CON)C(N)=O.[H][H] |
| InChI | InChI=1S/C9H19N3O3.H2/c1-7(9(10)14)4-2-3-5-12-8(13)6-15-11;/h7H,2-6,11H2,1H3,(H2,10,14)(H,12,13);1H |
| InChIKey | NHMDEDDMDGNMAT-UHFFFAOYSA-N |
| XLogP | -0.47 |
| TPSA | 107.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.28 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|