C18H28N4O4 — CID 175919267
6-[(2-aminooxyacetyl)amino]-2-(4-phenylbutanoylamino)hexanamide (PubChem CID 175919267) has the molecular formula C18H28N4O4 and a molecular weight of 364.45 g/mol. Its IUPAC name is 6-[(2-aminooxyacetyl)amino]-2-(4-phenylbutanoylamino)hexanamide.
| Compound Name | 6-[(2-aminooxyacetyl)amino]-2-(4-phenylbutanoylamino)hexanamide |
|---|---|
| PubChem CID | 175919267 |
| Molecular Formula | C18H28N4O4 |
| Molecular Weight | 364.45 g/mol |
| Exact Mass | 364.21 |
| IUPAC Name | 6-[(2-aminooxyacetyl)amino]-2-(4-phenylbutanoylamino)hexanamide |
| SMILES | NOCC(=O)NCCCCC(NC(=O)CCCc1ccccc1)C(N)=O |
| InChI | InChI=1S/C18H28N4O4/c19-18(25)15(10-4-5-12-21-17(24)13-26-20)22-16(23)11-6-9-14-7-2-1-3-8-14/h1-3,7-8,15H,4-6,9-13,20H2,(H2,19,25)(H,21,24)(H,22,23) |
| InChIKey | HIPBXOUUBHYLDT-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 136.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.45 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|