C26H38N4O8 — CID 70141954
(2S)-5-amino-2-[6-[[(4S)-4-carboxy-4-(4-phenylbutanoylamino)butanoyl]amino]hexanoylamino]-5-oxopentanoic acid (PubChem CID 70141954) has the molecular formula C26H38N4O8 and a molecular weight of 534.61 g/mol. Its IUPAC name is (2S)-5-amino-2-[6-[[(4S)-4-carboxy-4-(4-phenylbutanoylamino)butanoyl]amino]hexanoylamino]-5-oxopentanoic acid.
| Compound Name | (2S)-5-amino-2-[6-[[(4S)-4-carboxy-4-(4-phenylbutanoylamino)butanoyl]amino]hexanoylamino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 70141954 |
| Molecular Formula | C26H38N4O8 |
| Molecular Weight | 534.61 g/mol |
| Exact Mass | 534.27 |
| IUPAC Name | (2S)-5-amino-2-[6-[[(4S)-4-carboxy-4-(4-phenylbutanoylamino)butanoyl]amino]hexanoylamino]-5-oxopentanoic acid |
| SMILES | NC(=O)CC[C@H](NC(=O)CCCCCNC(=O)CC[C@H](NC(=O)CCCc1ccccc1)C(=O)O)C(=O)O |
| InChI | InChI=1S/C26H38N4O8/c27-21(31)15-13-19(25(35)36)29-23(33)11-5-2-6-17-28-22(32)16-14-20(26(37)38)30-24(34)12-7-10-18-8-3-1-4-9-18/h1,3-4,8-9,19-20H,2,5-7,10-17H2,(H2,27,31)(H,28,32)(H,29,33)(H,30,34)(H,35,36)(H,37,38)/t19-,20-/m0/s1 |
| InChIKey | ODWIWICSHRYYDD-PMACEKPBSA-N |
| XLogP | 0.87 |
| TPSA | 204.99 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.61 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|