C36H50Cl4N2O4 — CID 58107663
2,6-bis[4-[4-(1,5-dichloropentan-3-yl)phenyl]butanoylamino]hexanoic acid (PubChem CID 58107663) has the molecular formula C36H50Cl4N2O4 and a molecular weight of 716.62 g/mol. Its IUPAC name is 2,6-bis[4-[4-(1,5-dichloropentan-3-yl)phenyl]butanoylamino]hexanoic acid.
| Compound Name | 2,6-bis[4-[4-(1,5-dichloropentan-3-yl)phenyl]butanoylamino]hexanoic acid |
|---|---|
| PubChem CID | 58107663 |
| Molecular Formula | C36H50Cl4N2O4 |
| Molecular Weight | 716.62 g/mol |
| Exact Mass | 714.25 |
| IUPAC Name | 2,6-bis[4-[4-(1,5-dichloropentan-3-yl)phenyl]butanoylamino]hexanoic acid |
| SMILES | O=C(CCCc1ccc(C(CCCl)CCCl)cc1)NCCCCC(NC(=O)CCCc1ccc(C(CCCl)CCCl)cc1)C(=O)O |
| InChI | InChI=1S/C36H50Cl4N2O4/c37-22-18-31(19-23-38)29-14-10-27(11-15-29)5-3-8-34(43)41-26-2-1-7-33(36(45)46)42-35(44)9-4-6-28-12-16-30(17-13-28)32(20-24-39)21-25-40/h10-17,31-33H,1-9,18-26H2,(H,41,43)(H,42,44)(H,45,46) |
| InChIKey | WZYCYOBKRXBHDQ-UHFFFAOYSA-N |
| XLogP | 8.57 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 716.62 |
| LogP ≤ 5 | 8.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|