C19H27Cl2NO3 — CID 158191606
(2S)-2-amino-8-[4-(1,5-dichloropentan-3-yl)phenyl]-5-oxooctanoic acid (PubChem CID 158191606) has the molecular formula C19H27Cl2NO3 and a molecular weight of 388.34 g/mol. Its IUPAC name is (2S)-2-amino-8-[4-(1,5-dichloropentan-3-yl)phenyl]-5-oxooctanoic acid.
| Compound Name | (2S)-2-amino-8-[4-(1,5-dichloropentan-3-yl)phenyl]-5-oxooctanoic acid |
|---|---|
| PubChem CID | 158191606 |
| Molecular Formula | C19H27Cl2NO3 |
| Molecular Weight | 388.34 g/mol |
| Exact Mass | 387.14 |
| IUPAC Name | (2S)-2-amino-8-[4-(1,5-dichloropentan-3-yl)phenyl]-5-oxooctanoic acid |
| SMILES | N[C@@H](CCC(=O)CCCc1ccc(C(CCCl)CCCl)cc1)C(=O)O |
| InChI | InChI=1S/C19H27Cl2NO3/c20-12-10-16(11-13-21)15-6-4-14(5-7-15)2-1-3-17(23)8-9-18(22)19(24)25/h4-7,16,18H,1-3,8-13,22H2,(H,24,25)/t18-/m0/s1 |
| InChIKey | FZVASVLGGLQTDO-SFHVURJKSA-N |
| XLogP | 4.11 |
| TPSA | 80.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.34 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|