C24H38Cl2N2O2 — CID 89147243
4-[4-(1,5-dichloropentan-3-yl)phenyl]-N-[1-(ethylamino)-5-oxoheptan-4-yl]butanamide (PubChem CID 89147243) has the molecular formula C24H38Cl2N2O2 and a molecular weight of 457.49 g/mol. Its IUPAC name is 4-[4-(1,5-dichloropentan-3-yl)phenyl]-N-[1-(ethylamino)-5-oxoheptan-4-yl]butanamide.
| Compound Name | 4-[4-(1,5-dichloropentan-3-yl)phenyl]-N-[1-(ethylamino)-5-oxoheptan-4-yl]butanamide |
|---|---|
| PubChem CID | 89147243 |
| Molecular Formula | C24H38Cl2N2O2 |
| Molecular Weight | 457.49 g/mol |
| Exact Mass | 456.23 |
| IUPAC Name | 4-[4-(1,5-dichloropentan-3-yl)phenyl]-N-[1-(ethylamino)-5-oxoheptan-4-yl]butanamide |
| SMILES | CCNCCCC(NC(=O)CCCc1ccc(C(CCCl)CCCl)cc1)C(=O)CC |
| InChI | InChI=1S/C24H38Cl2N2O2/c1-3-23(29)22(8-6-18-27-4-2)28-24(30)9-5-7-19-10-12-20(13-11-19)21(14-16-25)15-17-26/h10-13,21-22,27H,3-9,14-18H2,1-2H3,(H,28,30) |
| InChIKey | FQODDGMZSMGJHC-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.49 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|