C25H27IN2O4 — CID 166632398
(2S)-2-[(4-ethynylbenzoyl)amino]-6-[4-(4-iodophenyl)butanoylamino]hexanoic acid (PubChem CID 166632398) has the molecular formula C25H27IN2O4 and a molecular weight of 546.41 g/mol. Its IUPAC name is (2S)-2-[(4-ethynylbenzoyl)amino]-6-[4-(4-iodophenyl)butanoylamino]hexanoic acid.
| Compound Name | (2S)-2-[(4-ethynylbenzoyl)amino]-6-[4-(4-iodophenyl)butanoylamino]hexanoic acid |
|---|---|
| PubChem CID | 166632398 |
| Molecular Formula | C25H27IN2O4 |
| Molecular Weight | 546.41 g/mol |
| Exact Mass | 546.10 |
| IUPAC Name | (2S)-2-[(4-ethynylbenzoyl)amino]-6-[4-(4-iodophenyl)butanoylamino]hexanoic acid |
| SMILES | C#Cc1ccc(C(=O)N[C@@H](CCCCNC(=O)CCCc2ccc(I)cc2)C(=O)O)cc1 |
| InChI | InChI=1S/C25H27IN2O4/c1-2-18-9-13-20(14-10-18)24(30)28-22(25(31)32)7-3-4-17-27-23(29)8-5-6-19-11-15-21(26)16-12-19/h1,9-16,22H,3-8,17H2,(H,27,29)(H,28,30)(H,31,32)/t22-/m0/s1 |
| InChIKey | AOSSQYIBOPFWIP-QFIPXVFZSA-N |
| XLogP | 3.76 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.41 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|