C37H60IN7O9 — CID 167106826
2-[4,7-bis(carboxymethyl)-10-[2-[[(2S)-6-[4-(4-iodophenyl)butanoylamino]-1-(3-methylbutylamino)-1-oxohexan-2-yl]amino]-2-oxoethyl]-1,4,7,10-tetrazacyclododec-1-yl]acetic acid (PubChem CID 167106826) has the molecular formula C37H60IN7O9 and a molecular weight of 873.83 g/mol. Its IUPAC name is 2-[4,7-bis(carboxymethyl)-10-[2-[[(2S)-6-[4-(4-iodophenyl)butanoylamino]-1-(3-methylbutylamino)-1-oxohexan-2-yl]amino]-2-oxoethyl]-1,4,7,10-tetrazacyclododec-1-yl]acetic acid.
| Compound Name | 2-[4,7-bis(carboxymethyl)-10-[2-[[(2S)-6-[4-(4-iodophenyl)butanoylamino]-1-(3-methylbutylamino)-1-oxohexan-2-yl]amino]-2-oxoethyl]-1,4,7,10-tetrazacyclododec-1-yl]acetic acid |
|---|---|
| PubChem CID | 167106826 |
| Molecular Formula | C37H60IN7O9 |
| Molecular Weight | 873.83 g/mol |
| Exact Mass | 873.35 |
| IUPAC Name | 2-[4,7-bis(carboxymethyl)-10-[2-[[(2S)-6-[4-(4-iodophenyl)butanoylamino]-1-(3-methylbutylamino)-1-oxohexan-2-yl]amino]-2-oxoethyl]-1,4,7,10-tetrazacyclododec-1-yl]acetic acid |
| SMILES | CC(C)CCNC(=O)[C@H](CCCCNC(=O)CCCc1ccc(I)cc1)NC(=O)CN1CCN(CC(=O)O)CCN(CC(=O)O)CCN(CC(=O)O)CC1 |
| InChI | InChI=1S/C37H60IN7O9/c1-28(2)13-15-40-37(54)31(7-3-4-14-39-32(46)8-5-6-29-9-11-30(38)12-10-29)41-33(47)24-42-16-18-43(25-34(48)49)20-22-45(27-36(52)53)23-21-44(19-17-42)26-35(50)51/h9-12,28,31H,3-8,13-27H2,1-2H3,(H,39,46)(H,40,54)(H,41,47)(H,48,49)(H,50,51)(H,52,53)/t31-/m0/s1 |
| InChIKey | XKWKFYKOOODOOH-HKBQPEDESA-N |
| XLogP | 1.02 |
| TPSA | 212.16 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 873.83 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|