C34H51FIN7O10 — CID 170128463
2-[4-[2-[[(2S)-1-acetamido-4-fluoro-6-[4-(4-iodophenyl)butanoylamino]-1-oxohexan-2-yl]amino]-2-oxoethyl]-7,10-bis(carboxymethyl)-1,4,7,10-tetrazacyclododec-1-yl]acetic acid (PubChem CID 170128463) has the molecular formula C34H51FIN7O10 and a molecular weight of 863.72 g/mol. Its IUPAC name is 2-[4-[2-[[(2S)-1-acetamido-4-fluoro-6-[4-(4-iodophenyl)butanoylamino]-1-oxohexan-2-yl]amino]-2-oxoethyl]-7,10-bis(carboxymethyl)-1,4,7,10-tetrazacyclododec-1-yl]acetic acid.
| Compound Name | 2-[4-[2-[[(2S)-1-acetamido-4-fluoro-6-[4-(4-iodophenyl)butanoylamino]-1-oxohexan-2-yl]amino]-2-oxoethyl]-7,10-bis(carboxymethyl)-1,4,7,10-tetrazacyclododec-1-yl]acetic acid |
|---|---|
| PubChem CID | 170128463 |
| Molecular Formula | C34H51FIN7O10 |
| Molecular Weight | 863.72 g/mol |
| Exact Mass | 863.27 |
| IUPAC Name | 2-[4-[2-[[(2S)-1-acetamido-4-fluoro-6-[4-(4-iodophenyl)butanoylamino]-1-oxohexan-2-yl]amino]-2-oxoethyl]-7,10-bis(carboxymethyl)-1,4,7,10-tetrazacyclododec-1-yl]acetic acid |
| SMILES | CC(=O)NC(=O)[C@H](CC(F)CCNC(=O)CCCc1ccc(I)cc1)NC(=O)CN1CCN(CC(=O)O)CCN(CC(=O)O)CCN(CC(=O)O)CC1 |
| InChI | InChI=1S/C34H51FIN7O10/c1-24(44)38-34(53)28(19-26(35)9-10-37-29(45)4-2-3-25-5-7-27(36)8-6-25)39-30(46)20-40-11-13-41(21-31(47)48)15-17-43(23-33(51)52)18-16-42(14-12-40)22-32(49)50/h5-8,26,28H,2-4,9-23H2,1H3,(H,37,45)(H,39,46)(H,47,48)(H,49,50)(H,51,52)(H,38,44,53)/t26?,28-/m0/s1 |
| InChIKey | VBWLCXZVDMECGN-RXBHZZDJSA-N |
| XLogP | -0.53 |
| TPSA | 229.23 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 53 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 863.72 |
| LogP ≤ 5 | -0.53 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|