C39H65IN6O13 — CID 155243894
2-[7-[1-carboxy-4-[2-[2-[2-[4-(4-iodophenyl)butanoylamino]ethoxy]ethoxy]ethylamino]-4-oxobutyl]-4,10-bis(2,2-dihydroxyethyl)-1,4,7,10-tetrazacyclododec-1-yl]-5-oxohexanoic acid (PubChem CID 155243894) has the molecular formula C39H65IN6O13 and a molecular weight of 952.88 g/mol. Its IUPAC name is 2-[7-[1-carboxy-4-[2-[2-[2-[4-(4-iodophenyl)butanoylamino]ethoxy]ethoxy]ethylamino]-4-oxobutyl]-4,10-bis(2,2-dihydroxyethyl)-1,4,7,10-tetrazacyclododec-1-yl]-5-oxohexanoic acid.
| Compound Name | 2-[7-[1-carboxy-4-[2-[2-[2-[4-(4-iodophenyl)butanoylamino]ethoxy]ethoxy]ethylamino]-4-oxobutyl]-4,10-bis(2,2-dihydroxyethyl)-1,4,7,10-tetrazacyclododec-1-yl]-5-oxohexanoic acid |
|---|---|
| PubChem CID | 155243894 |
| Molecular Formula | C39H65IN6O13 |
| Molecular Weight | 952.88 g/mol |
| Exact Mass | 952.37 |
| IUPAC Name | 2-[7-[1-carboxy-4-[2-[2-[2-[4-(4-iodophenyl)butanoylamino]ethoxy]ethoxy]ethylamino]-4-oxobutyl]-4,10-bis(2,2-dihydroxyethyl)-1,4,7,10-tetrazacyclododec-1-yl]-5-oxohexanoic acid |
| SMILES | CC(=O)CCC(C(=O)O)N1CCN(CC(O)O)CCN(C(CCC(=O)NCCOCCOCCNC(=O)CCCc2ccc(I)cc2)C(=O)O)CCN(CC(O)O)CC1 |
| InChI | InChI=1S/C39H65IN6O13/c1-29(47)5-10-32(38(54)55)45-19-15-43(27-36(50)51)17-21-46(22-18-44(16-20-45)28-37(52)53)33(39(56)57)11-12-35(49)42-14-24-59-26-25-58-23-13-41-34(48)4-2-3-30-6-8-31(40)9-7-30/h6-9,32-33,36-37,50-53H,2-5,10-28H2,1H3,(H,41,48)(H,42,49)(H,54,55)(H,56,57) |
| InChIKey | OIQBKAZVZQBUEK-UHFFFAOYSA-N |
| XLogP | -1.22 |
| TPSA | 262.21 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 59 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 952.88 |
| LogP ≤ 5 | -1.22 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|