C30H55N5O13 — CID 171508424
5-oxo-5-[2-[2-[2-(2-propoxyethoxy)ethoxy]ethoxy]ethylamino]-2-[4,7,10-tris(carboxymethyl)-1,4,7,10-tetrazacyclododec-1-yl]pentanoic acid (PubChem CID 171508424) has the molecular formula C30H55N5O13 and a molecular weight of 693.79 g/mol. Its IUPAC name is 5-oxo-5-[2-[2-[2-(2-propoxyethoxy)ethoxy]ethoxy]ethylamino]-2-[4,7,10-tris(carboxymethyl)-1,4,7,10-tetrazacyclododec-1-yl]pentanoic acid.
| Compound Name | 5-oxo-5-[2-[2-[2-(2-propoxyethoxy)ethoxy]ethoxy]ethylamino]-2-[4,7,10-tris(carboxymethyl)-1,4,7,10-tetrazacyclododec-1-yl]pentanoic acid |
|---|---|
| PubChem CID | 171508424 |
| Molecular Formula | C30H55N5O13 |
| Molecular Weight | 693.79 g/mol |
| Exact Mass | 693.38 |
| IUPAC Name | 5-oxo-5-[2-[2-[2-(2-propoxyethoxy)ethoxy]ethoxy]ethylamino]-2-[4,7,10-tris(carboxymethyl)-1,4,7,10-tetrazacyclododec-1-yl]pentanoic acid |
| SMILES | CCCOCCOCCOCCOCCNC(=O)CCC(C(=O)O)N1CCN(CC(=O)O)CCN(CC(=O)O)CCN(CC(=O)O)CC1 |
| InChI | InChI=1S/C30H55N5O13/c1-2-14-45-16-18-47-20-21-48-19-17-46-15-5-31-26(36)4-3-25(30(43)44)35-12-10-33(23-28(39)40)8-6-32(22-27(37)38)7-9-34(11-13-35)24-29(41)42/h25H,2-24H2,1H3,(H,31,36)(H,37,38)(H,39,40)(H,41,42)(H,43,44) |
| InChIKey | VDMKUJDNYOFRLP-UHFFFAOYSA-N |
| XLogP | -1.71 |
| TPSA | 228.18 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 693.79 |
| LogP ≤ 5 | -1.71 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|