C23H39N9O10 — CID 155414899
5-[2-[(2-azidoacetyl)amino]ethylamino]-5-oxo-2-[4,7,10-tris(carboxymethyl)-1,4,7,10-tetrazacyclododec-1-yl]pentanoic acid (PubChem CID 155414899) has the molecular formula C23H39N9O10 and a molecular weight of 601.62 g/mol. Its IUPAC name is 5-[2-[(2-azidoacetyl)amino]ethylamino]-5-oxo-2-[4,7,10-tris(carboxymethyl)-1,4,7,10-tetrazacyclododec-1-yl]pentanoic acid.
| Compound Name | 5-[2-[(2-azidoacetyl)amino]ethylamino]-5-oxo-2-[4,7,10-tris(carboxymethyl)-1,4,7,10-tetrazacyclododec-1-yl]pentanoic acid |
|---|---|
| PubChem CID | 155414899 |
| Molecular Formula | C23H39N9O10 |
| Molecular Weight | 601.62 g/mol |
| Exact Mass | 601.28 |
| IUPAC Name | 5-[2-[(2-azidoacetyl)amino]ethylamino]-5-oxo-2-[4,7,10-tris(carboxymethyl)-1,4,7,10-tetrazacyclododec-1-yl]pentanoic acid |
| SMILES | [N-]=[N+]=NCC(=O)NCCNC(=O)CCC(C(=O)O)N1CCN(CC(=O)O)CCN(CC(=O)O)CCN(CC(=O)O)CC1 |
| InChI | InChI=1S/C23H39N9O10/c24-28-27-13-19(34)26-4-3-25-18(33)2-1-17(23(41)42)32-11-9-30(15-21(37)38)7-5-29(14-20(35)36)6-8-31(10-12-32)16-22(39)40/h17H,1-16H2,(H,25,33)(H,26,34)(H,35,36)(H,37,38)(H,39,40)(H,41,42) |
| InChIKey | BLUWXHWIIXIQRC-UHFFFAOYSA-N |
| XLogP | -2.76 |
| TPSA | 269.12 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 42 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.62 |
| LogP ≤ 5 | -2.76 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|