C17H32N6O7 — CID 164874681
2-[4,7-bis(carboxymethyl)-1,4,7-triazonan-1-yl]-5-(2-hydrazinylethylamino)-5-oxopentanoic acid (PubChem CID 164874681) has the molecular formula C17H32N6O7 and a molecular weight of 432.48 g/mol. Its IUPAC name is 2-[4,7-bis(carboxymethyl)-1,4,7-triazonan-1-yl]-5-(2-hydrazinylethylamino)-5-oxopentanoic acid.
| Compound Name | 2-[4,7-bis(carboxymethyl)-1,4,7-triazonan-1-yl]-5-(2-hydrazinylethylamino)-5-oxopentanoic acid |
|---|---|
| PubChem CID | 164874681 |
| Molecular Formula | C17H32N6O7 |
| Molecular Weight | 432.48 g/mol |
| Exact Mass | 432.23 |
| IUPAC Name | 2-[4,7-bis(carboxymethyl)-1,4,7-triazonan-1-yl]-5-(2-hydrazinylethylamino)-5-oxopentanoic acid |
| SMILES | NNCCNC(=O)CCC(C(=O)O)N1CCN(CC(=O)O)CCN(CC(=O)O)CC1 |
| InChI | InChI=1S/C17H32N6O7/c18-20-4-3-19-14(24)2-1-13(17(29)30)23-9-7-21(11-15(25)26)5-6-22(8-10-23)12-16(27)28/h13,20H,1-12,18H2,(H,19,24)(H,25,26)(H,27,28)(H,29,30) |
| InChIKey | HBWIVSBPHDWKTA-UHFFFAOYSA-N |
| XLogP | -3.11 |
| TPSA | 188.77 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.48 |
| LogP ≤ 5 | -3.11 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|