C24H43N5O8 — CID 166544505
2-[4,7-bis(carboxymethyl)-1,4,7-triazonan-1-yl]-5-[5-(2-methylpropanoylamino)pentylamino]-5-oxopentanoic acid (PubChem CID 166544505) has the molecular formula C24H43N5O8 and a molecular weight of 529.64 g/mol. Its IUPAC name is 2-[4,7-bis(carboxymethyl)-1,4,7-triazonan-1-yl]-5-[5-(2-methylpropanoylamino)pentylamino]-5-oxopentanoic acid.
| Compound Name | 2-[4,7-bis(carboxymethyl)-1,4,7-triazonan-1-yl]-5-[5-(2-methylpropanoylamino)pentylamino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 166544505 |
| Molecular Formula | C24H43N5O8 |
| Molecular Weight | 529.64 g/mol |
| Exact Mass | 529.31 |
| IUPAC Name | 2-[4,7-bis(carboxymethyl)-1,4,7-triazonan-1-yl]-5-[5-(2-methylpropanoylamino)pentylamino]-5-oxopentanoic acid |
| SMILES | CC(C)C(=O)NCCCCCNC(=O)CCC(C(=O)O)N1CCN(CC(=O)O)CCN(CC(=O)O)CC1 |
| InChI | InChI=1S/C24H43N5O8/c1-18(2)23(35)26-9-5-3-4-8-25-20(30)7-6-19(24(36)37)29-14-12-27(16-21(31)32)10-11-28(13-15-29)17-22(33)34/h18-19H,3-17H2,1-2H3,(H,25,30)(H,26,35)(H,31,32)(H,33,34)(H,36,37) |
| InChIKey | ZSWYWWRFTIUFDH-UHFFFAOYSA-N |
| XLogP | -0.63 |
| TPSA | 179.82 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.64 |
| LogP ≤ 5 | -0.63 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|