2-[4,7-bis(carboxymethyl)-1,4,7-triazonan-1-yl]pentanoic acid

C15H27N3O6 — CID 163915951

IUPAC2-[4,7-bis(carboxymethyl)-1,4,7-triazonan-1-yl]pentanoic acid
SMILESCCCC(C(=O)O)N1CCN(CC(=O)O)CCN(CC(=O)O)CC1
InChIInChI=1S/C15H27N3O6/c1-2-3-12(15(23)24)18-8-6-16(10-13(19)20)4-5-17(7-9-18)11-14(21)22/h12H,2-11H2,1H3,(H,19,20)(H,21,22)(H,23,24)
InChIKeyQWGFVXDHEHIQSC-UHFFFAOYSA-N
MW345.40 g/mol
LogP-0.67
Rot. Bonds8

About 2-[4,7-bis(carboxymethyl)-1,4,7-triazonan-1-yl]pentanoic acid

2-[4,7-bis(carboxymethyl)-1,4,7-triazonan-1-yl]pentanoic acid (PubChem CID 163915951) has the molecular formula C15H27N3O6 and a molecular weight of 345.40 g/mol. Its IUPAC name is 2-[4,7-bis(carboxymethyl)-1,4,7-triazonan-1-yl]pentanoic acid.

Molecular Properties

Compound Name2-[4,7-bis(carboxymethyl)-1,4,7-triazonan-1-yl]pentanoic acid
PubChem CID163915951
Molecular FormulaC15H27N3O6
Molecular Weight345.40 g/mol
Exact Mass345.19
IUPAC Name2-[4,7-bis(carboxymethyl)-1,4,7-triazonan-1-yl]pentanoic acid
SMILESCCCC(C(=O)O)N1CCN(CC(=O)O)CCN(CC(=O)O)CC1
InChIInChI=1S/C15H27N3O6/c1-2-3-12(15(23)24)18-8-6-16(10-13(19)20)4-5-17(7-9-18)11-14(21)22/h12H,2-11H2,1H3,(H,19,20)(H,21,22)(H,23,24)
InChIKeyQWGFVXDHEHIQSC-UHFFFAOYSA-N
XLogP-0.67
TPSA121.62 Ų
H-Bond Donors3
H-Bond Acceptors6
Rotatable Bonds8
Heavy Atoms24
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500345.40
LogP ≤ 5-0.67
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 106

Analyze 2-[4,7-bis(carboxymethyl)-1,4,7-triazonan-1-yl]pentanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[4,7-bis(carboxymethyl)-1,4,7-triazonan-1-yl]pentanoic acid?
The IUPAC name of 2-[4,7-bis(carboxymethyl)-1,4,7-triazonan-1-yl]pentanoic acid (CID 163915951) is 2-[4,7-bis(carboxymethyl)-1,4,7-triazonan-1-yl]pentanoic acid.
What is the SMILES notation for 2-[4,7-bis(carboxymethyl)-1,4,7-triazonan-1-yl]pentanoic acid?
The canonical SMILES for 2-[4,7-bis(carboxymethyl)-1,4,7-triazonan-1-yl]pentanoic acid is CCCC(C(=O)O)N1CCN(CC(=O)O)CCN(CC(=O)O)CC1.
What is the InChIKey of 2-[4,7-bis(carboxymethyl)-1,4,7-triazonan-1-yl]pentanoic acid?
The InChIKey is QWGFVXDHEHIQSC-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H27N3O6/c1-2-3-12(15(23)24)18-8-6-16(10-13(19)20)4-5-17(7-9-18)11-14(21)22/h12H,2-11H2,1H3,(H,19,20)(H,21,22)(H,23,24).
What are the key properties of 2-[4,7-bis(carboxymethyl)-1,4,7-triazonan-1-yl]pentanoic acid?
2-[4,7-bis(carboxymethyl)-1,4,7-triazonan-1-yl]pentanoic acid has a molecular weight of 345.40 g/mol, XLogP of -0.67, 8 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4,7-bis(carboxymethyl)-1,4,7-triazonan-1-yl]pentanoic acid is sourced from PubChem (CID 163915951), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).