C15H27N3O6 — CID 163915951
2-[4,7-bis(carboxymethyl)-1,4,7-triazonan-1-yl]pentanoic acid (PubChem CID 163915951) has the molecular formula C15H27N3O6 and a molecular weight of 345.40 g/mol. Its IUPAC name is 2-[4,7-bis(carboxymethyl)-1,4,7-triazonan-1-yl]pentanoic acid.
| Compound Name | 2-[4,7-bis(carboxymethyl)-1,4,7-triazonan-1-yl]pentanoic acid |
|---|---|
| PubChem CID | 163915951 |
| Molecular Formula | C15H27N3O6 |
| Molecular Weight | 345.40 g/mol |
| Exact Mass | 345.19 |
| IUPAC Name | 2-[4,7-bis(carboxymethyl)-1,4,7-triazonan-1-yl]pentanoic acid |
| SMILES | CCCC(C(=O)O)N1CCN(CC(=O)O)CCN(CC(=O)O)CC1 |
| InChI | InChI=1S/C15H27N3O6/c1-2-3-12(15(23)24)18-8-6-16(10-13(19)20)4-5-17(7-9-18)11-14(21)22/h12H,2-11H2,1H3,(H,19,20)(H,21,22)(H,23,24) |
| InChIKey | QWGFVXDHEHIQSC-UHFFFAOYSA-N |
| XLogP | -0.67 |
| TPSA | 121.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.40 |
| LogP ≤ 5 | -0.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |