C23H35N5O7 — CID 163637486
2-[6,9-bis(carboxymethyl)-3,6,9,15-tetrazabicyclo[9.3.1]pentadeca-1(14),11(15),12-trien-3-yl]-5-oxo-5-(propylamino)pentanoic acid (PubChem CID 163637486) has the molecular formula C23H35N5O7 and a molecular weight of 493.56 g/mol. Its IUPAC name is 2-[6,9-bis(carboxymethyl)-3,6,9,15-tetrazabicyclo[9.3.1]pentadeca-1(14),11(15),12-trien-3-yl]-5-oxo-5-(propylamino)pentanoic acid.
| Compound Name | 2-[6,9-bis(carboxymethyl)-3,6,9,15-tetrazabicyclo[9.3.1]pentadeca-1(14),11(15),12-trien-3-yl]-5-oxo-5-(propylamino)pentanoic acid |
|---|---|
| PubChem CID | 163637486 |
| Molecular Formula | C23H35N5O7 |
| Molecular Weight | 493.56 g/mol |
| Exact Mass | 493.25 |
| IUPAC Name | 2-[6,9-bis(carboxymethyl)-3,6,9,15-tetrazabicyclo[9.3.1]pentadeca-1(14),11(15),12-trien-3-yl]-5-oxo-5-(propylamino)pentanoic acid |
| SMILES | CCCNC(=O)CCC(C(=O)O)N1CCN(CC(=O)O)CCN(CC(=O)O)Cc2cccc(n2)C1 |
| InChI | InChI=1S/C23H35N5O7/c1-2-8-24-20(29)7-6-19(23(34)35)28-12-11-26(15-21(30)31)9-10-27(16-22(32)33)13-17-4-3-5-18(14-28)25-17/h3-5,19H,2,6-16H2,1H3,(H,24,29)(H,30,31)(H,32,33)(H,34,35) |
| InChIKey | IBLAQJOTAYNYBF-UHFFFAOYSA-N |
| XLogP | -0.07 |
| TPSA | 163.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.56 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |