C23H37N7O7 — CID 166131957
5-[3-[3,9-bis(carboxymethyl)-3,6,9,15-tetrazabicyclo[9.3.1]pentadeca-1(15),11,13-trien-6-yl]propylamino]-2-hydrazinyl-5-oxopentanoic acid (PubChem CID 166131957) has the molecular formula C23H37N7O7 and a molecular weight of 523.59 g/mol. Its IUPAC name is 5-[3-[3,9-bis(carboxymethyl)-3,6,9,15-tetrazabicyclo[9.3.1]pentadeca-1(15),11,13-trien-6-yl]propylamino]-2-hydrazinyl-5-oxopentanoic acid.
| Compound Name | 5-[3-[3,9-bis(carboxymethyl)-3,6,9,15-tetrazabicyclo[9.3.1]pentadeca-1(15),11,13-trien-6-yl]propylamino]-2-hydrazinyl-5-oxopentanoic acid |
|---|---|
| PubChem CID | 166131957 |
| Molecular Formula | C23H37N7O7 |
| Molecular Weight | 523.59 g/mol |
| Exact Mass | 523.28 |
| IUPAC Name | 5-[3-[3,9-bis(carboxymethyl)-3,6,9,15-tetrazabicyclo[9.3.1]pentadeca-1(15),11,13-trien-6-yl]propylamino]-2-hydrazinyl-5-oxopentanoic acid |
| SMILES | NNC(CCC(=O)NCCCN1CCN(CC(=O)O)Cc2cccc(n2)CN(CC(=O)O)CC1)C(=O)O |
| InChI | InChI=1S/C23H37N7O7/c24-27-19(23(36)37)5-6-20(31)25-7-2-8-28-9-11-29(15-21(32)33)13-17-3-1-4-18(26-17)14-30(12-10-28)16-22(34)35/h1,3-4,19,27H,2,5-16,24H2,(H,25,31)(H,32,33)(H,34,35)(H,36,37) |
| InChIKey | CDPCTHIMLLGQRD-UHFFFAOYSA-N |
| XLogP | -1.63 |
| TPSA | 201.66 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.59 |
| LogP ≤ 5 | -1.63 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|