C22H32N4O8 — CID 146978784
2-[9-(1,3-dicarboxypropyl)-6-methyl-3,6,9,15-tetrazabicyclo[9.3.1]pentadeca-1(15),11,13-trien-3-yl]pentanedioic acid (PubChem CID 146978784) has the molecular formula C22H32N4O8 and a molecular weight of 480.52 g/mol. Its IUPAC name is 2-[9-(1,3-dicarboxypropyl)-6-methyl-3,6,9,15-tetrazabicyclo[9.3.1]pentadeca-1(15),11,13-trien-3-yl]pentanedioic acid.
| Compound Name | 2-[9-(1,3-dicarboxypropyl)-6-methyl-3,6,9,15-tetrazabicyclo[9.3.1]pentadeca-1(15),11,13-trien-3-yl]pentanedioic acid |
|---|---|
| PubChem CID | 146978784 |
| Molecular Formula | C22H32N4O8 |
| Molecular Weight | 480.52 g/mol |
| Exact Mass | 480.22 |
| IUPAC Name | 2-[9-(1,3-dicarboxypropyl)-6-methyl-3,6,9,15-tetrazabicyclo[9.3.1]pentadeca-1(15),11,13-trien-3-yl]pentanedioic acid |
| SMILES | CN1CCN(C(CCC(=O)O)C(=O)O)Cc2cccc(n2)CN(C(CCC(=O)O)C(=O)O)CC1 |
| InChI | InChI=1S/C22H32N4O8/c1-24-9-11-25(17(21(31)32)5-7-19(27)28)13-15-3-2-4-16(23-15)14-26(12-10-24)18(22(33)34)6-8-20(29)30/h2-4,17-18H,5-14H2,1H3,(H,27,28)(H,29,30)(H,31,32)(H,33,34) |
| InChIKey | IZMKSMPMONRTLJ-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 171.81 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.52 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |