C22H30MnN6O4S2 — CID 153454650
2-[9-(1-carboxy-3-isothiocyanatopropyl)-6-methyl-3,6,9,15-tetrazabicyclo[9.3.1]pentadeca-1(15),11,13-trien-3-yl]-4-isothiocyanatobutanoic acid;manganese (PubChem CID 153454650) has the molecular formula C22H30MnN6O4S2 and a molecular weight of 561.59 g/mol. Its IUPAC name is 2-[9-(1-carboxy-3-isothiocyanatopropyl)-6-methyl-3,6,9,15-tetrazabicyclo[9.3.1]pentadeca-1(15),11,13-trien-3-yl]-4-isothiocyanatobutanoic acid;manganese.
| Compound Name | 2-[9-(1-carboxy-3-isothiocyanatopropyl)-6-methyl-3,6,9,15-tetrazabicyclo[9.3.1]pentadeca-1(15),11,13-trien-3-yl]-4-isothiocyanatobutanoic acid;manganese |
|---|---|
| PubChem CID | 153454650 |
| Molecular Formula | C22H30MnN6O4S2 |
| Molecular Weight | 561.59 g/mol |
| Exact Mass | 561.12 |
| IUPAC Name | 2-[9-(1-carboxy-3-isothiocyanatopropyl)-6-methyl-3,6,9,15-tetrazabicyclo[9.3.1]pentadeca-1(15),11,13-trien-3-yl]-4-isothiocyanatobutanoic acid;manganese |
| SMILES | CN1CCN(C(CCN=C=S)C(=O)O)Cc2cccc(n2)CN(C(CCN=C=S)C(=O)O)CC1.[Mn] |
| InChI | InChI=1S/C22H30N6O4S2.Mn/c1-26-9-11-27(19(21(29)30)5-7-23-15-33)13-17-3-2-4-18(25-17)14-28(12-10-26)20(22(31)32)6-8-24-16-34;/h2-4,19-20H,5-14H2,1H3,(H,29,30)(H,31,32); |
| InChIKey | WHTDUIQZTZJHKQ-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 121.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.59 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|