C43H65N5O7 — CID 76577137
2-[3,9-bis(carboxymethyl)-3,6,9,15-tetrazabicyclo[9.3.1]pentadeca-1(15),11,13-trien-6-yl]-4-[4-(octadec-9-enoylamino)phenyl]butanoic acid (PubChem CID 76577137) has the molecular formula C43H65N5O7 and a molecular weight of 764.02 g/mol. Its IUPAC name is 2-[3,9-bis(carboxymethyl)-3,6,9,15-tetrazabicyclo[9.3.1]pentadeca-1(15),11,13-trien-6-yl]-4-[4-(octadec-9-enoylamino)phenyl]butanoic acid.
| Compound Name | 2-[3,9-bis(carboxymethyl)-3,6,9,15-tetrazabicyclo[9.3.1]pentadeca-1(15),11,13-trien-6-yl]-4-[4-(octadec-9-enoylamino)phenyl]butanoic acid |
|---|---|
| PubChem CID | 76577137 |
| Molecular Formula | C43H65N5O7 |
| Molecular Weight | 764.02 g/mol |
| Exact Mass | 763.49 |
| IUPAC Name | 2-[3,9-bis(carboxymethyl)-3,6,9,15-tetrazabicyclo[9.3.1]pentadeca-1(15),11,13-trien-6-yl]-4-[4-(octadec-9-enoylamino)phenyl]butanoic acid |
| SMILES | CCCCCCCCC=CCCCCCCCC(=O)Nc1ccc(CCC(C(=O)O)N2CCN(CC(=O)O)Cc3cccc(n3)CN(CC(=O)O)CC2)cc1 |
| InChI | InChI=1S/C43H65N5O7/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-20-40(49)45-36-24-21-35(22-25-36)23-26-39(43(54)55)48-29-27-46(33-41(50)51)31-37-18-17-19-38(44-37)32-47(28-30-48)34-42(52)53/h9-10,17-19,21-22,24-25,39H,2-8,11-16,20,23,26-34H2,1H3,(H,45,49)(H,50,51)(H,52,53)(H,54,55) |
| InChIKey | BHRYQBUPTBQBKC-UHFFFAOYSA-N |
| XLogP | 7.23 |
| TPSA | 163.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 764.02 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|