C29H56N10O13 — CID 166131965
5-[2-[bis[2-[(2-aminooxyacetyl)amino]ethyl]amino]ethylamino]-2-[4,7-bis(carboxymethyl)-10-(2,2-dihydroxyethyl)-1,4,7,10-tetrazacyclododec-1-yl]-5-oxopentanoic acid (PubChem CID 166131965) has the molecular formula C29H56N10O13 and a molecular weight of 752.82 g/mol. Its IUPAC name is 5-[2-[bis[2-[(2-aminooxyacetyl)amino]ethyl]amino]ethylamino]-2-[4,7-bis(carboxymethyl)-10-(2,2-dihydroxyethyl)-1,4,7,10-tetrazacyclododec-1-yl]-5-oxopentanoic acid.
| Compound Name | 5-[2-[bis[2-[(2-aminooxyacetyl)amino]ethyl]amino]ethylamino]-2-[4,7-bis(carboxymethyl)-10-(2,2-dihydroxyethyl)-1,4,7,10-tetrazacyclododec-1-yl]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 166131965 |
| Molecular Formula | C29H56N10O13 |
| Molecular Weight | 752.82 g/mol |
| Exact Mass | 752.40 |
| IUPAC Name | 5-[2-[bis[2-[(2-aminooxyacetyl)amino]ethyl]amino]ethylamino]-2-[4,7-bis(carboxymethyl)-10-(2,2-dihydroxyethyl)-1,4,7,10-tetrazacyclododec-1-yl]-5-oxopentanoic acid |
| SMILES | NOCC(=O)NCCN(CCNC(=O)CCC(C(=O)O)N1CCN(CC(=O)O)CCN(CC(=O)O)CCN(CC(O)O)CC1)CCNC(=O)CON |
| InChI | InChI=1S/C29H56N10O13/c30-51-20-24(41)33-4-7-35(8-5-34-25(42)21-52-31)6-3-32-23(40)2-1-22(29(49)50)39-15-13-37(18-27(45)46)11-9-36(17-26(43)44)10-12-38(14-16-39)19-28(47)48/h22,27,45-46H,1-21,30-31H2,(H,32,40)(H,33,41)(H,34,42)(H,43,44)(H,47,48)(H,49,50) |
| InChIKey | PQYVPGPBHWLZTO-UHFFFAOYSA-N |
| XLogP | -6.65 |
| TPSA | 326.36 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 17 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 52 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 752.82 |
| LogP ≤ 5 | -6.65 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 17 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|